C19H14Cl3F3N2O2 — CID 26656158
(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 26656158) has the molecular formula C19H14Cl3F3N2O2 and a molecular weight of 465.69 g/mol. Its IUPAC name is (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 26656158 |
| Molecular Formula | C19H14Cl3F3N2O2 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | CN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)/C=C/c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C19H14Cl3F3N2O2/c1-27(10-16(28)26-18-14(21)3-2-4-15(18)22)17(29)8-5-11-9-12(19(23,24)25)6-7-13(11)20/h2-9H,10H2,1H3,(H,26,28)/b8-5+ |
| InChIKey | HIUGXVVAFHAAKR-VMPITWQZSA-N |
| XLogP | 5.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|