C21H20ClF3N2O2 — CID 55333062
3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylprop-2-enamide (PubChem CID 55333062) has the molecular formula C21H20ClF3N2O2 and a molecular weight of 424.85 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylprop-2-enamide.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 55333062 |
| Molecular Formula | C21H20ClF3N2O2 |
| Molecular Weight | 424.85 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-N-[2-(2-ethylanilino)-2-oxoethyl]-N-methylprop-2-enamide |
| SMILES | CCc1ccccc1NC(=O)CN(C)C(=O)C=Cc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C21H20ClF3N2O2/c1-3-14-6-4-5-7-18(14)26-19(28)13-27(2)20(29)11-8-15-12-16(21(23,24)25)9-10-17(15)22/h4-12H,3,13H2,1-2H3,(H,26,28) |
| InChIKey | OCDNFAVBLWWUPN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.85 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|