C20H18BrF3N2O2 — CID 17429331
(E)-3-(2-bromo-4-methylphenyl)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]prop-2-enamide (PubChem CID 17429331) has the molecular formula C20H18BrF3N2O2 and a molecular weight of 455.27 g/mol. Its IUPAC name is (E)-3-(2-bromo-4-methylphenyl)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-bromo-4-methylphenyl)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 17429331 |
| Molecular Formula | C20H18BrF3N2O2 |
| Molecular Weight | 455.27 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | (E)-3-(2-bromo-4-methylphenyl)-N-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)N(C)CC(=O)Nc2ccccc2C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C20H18BrF3N2O2/c1-13-7-8-14(16(21)11-13)9-10-19(28)26(2)12-18(27)25-17-6-4-3-5-15(17)20(22,23)24/h3-11H,12H2,1-2H3,(H,25,27)/b10-9+ |
| InChIKey | CPYYPVGLMQKDIX-MDZDMXLPSA-N |
| XLogP | 4.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|