C20H16Cl3F3N2O2 — CID 46647899
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylprop-2-enamide (PubChem CID 46647899) has the molecular formula C20H16Cl3F3N2O2 and a molecular weight of 479.71 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylprop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 46647899 |
| Molecular Formula | C20H16Cl3F3N2O2 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(2,6-dichloroanilino)-2-oxoethyl]-N-ethylprop-2-enamide |
| SMILES | CCN(CC(=O)Nc1c(Cl)cccc1Cl)C(=O)/C=C/c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16Cl3F3N2O2/c1-2-28(11-17(29)27-19-15(22)4-3-5-16(19)23)18(30)9-7-12-6-8-14(21)13(10-12)20(24,25)26/h3-10H,2,11H2,1H3,(H,27,29)/b9-7+ |
| InChIKey | NNCQHJRASOCIBL-VQHVLOKHSA-N |
| XLogP | 6.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|