C19H16ClF3N2O2 — CID 46584642
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(propanoylamino)phenyl]prop-2-enamide (PubChem CID 46584642) has the molecular formula C19H16ClF3N2O2 and a molecular weight of 396.80 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(propanoylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(propanoylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46584642 |
| Molecular Formula | C19H16ClF3N2O2 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(propanoylamino)phenyl]prop-2-enamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)/C=C/c2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H16ClF3N2O2/c1-2-17(26)24-13-4-3-5-14(11-13)25-18(27)9-7-12-6-8-16(20)15(10-12)19(21,22)23/h3-11H,2H2,1H3,(H,24,26)(H,25,27)/b9-7+ |
| InChIKey | VUTBGZBBSMQSKH-VQHVLOKHSA-N |
| XLogP | 5.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|