C18H13ClF3N5O — CID 46437289
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]prop-2-enamide (PubChem CID 46437289) has the molecular formula C18H13ClF3N5O and a molecular weight of 407.78 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46437289 |
| Molecular Formula | C18H13ClF3N5O |
| Molecular Weight | 407.78 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)/C=C/c2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H13ClF3N5O/c1-11-24-25-26-27(11)14-4-2-3-13(10-14)23-17(28)8-6-12-5-7-16(19)15(9-12)18(20,21)22/h2-10H,1H3,(H,23,28)/b8-6+ |
| InChIKey | UVEWFOHHODYAPW-SOFGYWHQSA-N |
| XLogP | 4.29 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|