C17H14ClF3N6O — CID 36912952
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[3-(5-methyltetrazol-1-yl)anilino]acetamide (PubChem CID 36912952) has the molecular formula C17H14ClF3N6O and a molecular weight of 410.79 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[3-(5-methyltetrazol-1-yl)anilino]acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[3-(5-methyltetrazol-1-yl)anilino]acetamide |
|---|---|
| PubChem CID | 36912952 |
| Molecular Formula | C17H14ClF3N6O |
| Molecular Weight | 410.79 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[3-(5-methyltetrazol-1-yl)anilino]acetamide |
| SMILES | Cc1nnnn1-c1cccc(NCC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H14ClF3N6O/c1-10-24-25-26-27(10)13-4-2-3-11(7-13)22-9-16(28)23-12-5-6-15(18)14(8-12)17(19,20)21/h2-8,22H,9H2,1H3,(H,23,28) |
| InChIKey | LTKVFXKRVFJCAF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.79 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |