C13H16ClN5O — CID 43701560
5-chloro-N-[3-(5-methyltetrazol-1-yl)phenyl]pentanamide (PubChem CID 43701560) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is 5-chloro-N-[3-(5-methyltetrazol-1-yl)phenyl]pentanamide.
| Compound Name | 5-chloro-N-[3-(5-methyltetrazol-1-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 43701560 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 5-chloro-N-[3-(5-methyltetrazol-1-yl)phenyl]pentanamide |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)CCCCCl)c1 |
| InChI | InChI=1S/C13H16ClN5O/c1-10-16-17-18-19(10)12-6-4-5-11(9-12)15-13(20)7-2-3-8-14/h4-6,9H,2-3,7-8H2,1H3,(H,15,20) |
| InChIKey | NSXGFYUZKORWJW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|