C9H10N6S — CID 169356763
[3-(5-methyltetrazol-1-yl)phenyl]thiourea (PubChem CID 169356763) has the molecular formula C9H10N6S and a molecular weight of 234.29 g/mol. Its IUPAC name is [3-(5-methyltetrazol-1-yl)phenyl]thiourea.
| Compound Name | [3-(5-methyltetrazol-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 169356763 |
| Molecular Formula | C9H10N6S |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | [3-(5-methyltetrazol-1-yl)phenyl]thiourea |
| SMILES | Cc1nnnn1-c1cccc(NC(N)=S)c1 |
| InChI | InChI=1S/C9H10N6S/c1-6-12-13-14-15(6)8-4-2-3-7(5-8)11-9(10)16/h2-5H,1H3,(H3,10,11,16) |
| InChIKey | PQYYQFHSBMGLQT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|