C15H13N5O2 — CID 69112128
phenyl N-[3-(5-methyltetrazol-1-yl)phenyl]carbamate (PubChem CID 69112128) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is phenyl N-[3-(5-methyltetrazol-1-yl)phenyl]carbamate.
| Compound Name | phenyl N-[3-(5-methyltetrazol-1-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 69112128 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | phenyl N-[3-(5-methyltetrazol-1-yl)phenyl]carbamate |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)Oc2ccccc2)c1 |
| InChI | InChI=1S/C15H13N5O2/c1-11-17-18-19-20(11)13-7-5-6-12(10-13)16-15(21)22-14-8-3-2-4-9-14/h2-10H,1H3,(H,16,21) |
| InChIKey | CMGNYOISKAALAN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |