C16H19N5O3 — CID 120672862
4-[[3-(5-methyltetrazol-1-yl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120672862) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-[[3-(5-methyltetrazol-1-yl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-(5-methyltetrazol-1-yl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120672862 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-[[3-(5-methyltetrazol-1-yl)phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)C2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C16H19N5O3/c1-10-18-19-20-21(10)14-4-2-3-13(9-14)17-15(22)11-5-7-12(8-6-11)16(23)24/h2-4,9,11-12H,5-8H2,1H3,(H,17,22)(H,23,24) |
| InChIKey | MAIMPHUEQJRMTH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |