C20H20N6O2 — CID 136576817
3-[(2-methylcyclopropanecarbonyl)amino]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide (PubChem CID 136576817) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-[(2-methylcyclopropanecarbonyl)amino]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide.
| Compound Name | 3-[(2-methylcyclopropanecarbonyl)amino]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 136576817 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-[(2-methylcyclopropanecarbonyl)amino]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)c2cccc(NC(=O)C3CC3C)c2)c1 |
| InChI | InChI=1S/C20H20N6O2/c1-12-9-18(12)20(28)22-15-6-3-5-14(10-15)19(27)21-16-7-4-8-17(11-16)26-13(2)23-24-25-26/h3-8,10-12,18H,9H2,1-2H3,(H,21,27)(H,22,28) |
| InChIKey | YOXFJKBQUWGPIT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |