C13H17ClN6O — CID 119733107
N-[3-(5-methyltetrazol-1-yl)phenyl]pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119733107) has the molecular formula C13H17ClN6O and a molecular weight of 308.77 g/mol. Its IUPAC name is N-[3-(5-methyltetrazol-1-yl)phenyl]pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-[3-(5-methyltetrazol-1-yl)phenyl]pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119733107 |
| Molecular Formula | C13H17ClN6O |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[3-(5-methyltetrazol-1-yl)phenyl]pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)C2CCNC2)c1.Cl |
| InChI | InChI=1S/C13H16N6O.ClH/c1-9-16-17-18-19(9)12-4-2-3-11(7-12)15-13(20)10-5-6-14-8-10;/h2-4,7,10,14H,5-6,8H2,1H3,(H,15,20);1H |
| InChIKey | KAGYUGRGVMHHID-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |