C22H26N6O2 — CID 92613775
1-[(4-methoxyphenyl)methyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]piperidine-4-carboxamide (PubChem CID 92613775) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92613775 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(CN2CCC(C(=O)Nc3cccc(-n4nnnc4C)c3)CC2)cc1 |
| InChI | InChI=1S/C22H26N6O2/c1-16-24-25-26-28(16)20-5-3-4-19(14-20)23-22(29)18-10-12-27(13-11-18)15-17-6-8-21(30-2)9-7-17/h3-9,14,18H,10-13,15H2,1-2H3,(H,23,29) |
| InChIKey | BRJIGSFWLXLWBK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |