C19H16N6O3S — CID 55676403
3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide (PubChem CID 55676403) has the molecular formula C19H16N6O3S and a molecular weight of 408.44 g/mol. Its IUPAC name is 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide.
| Compound Name | 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55676403 |
| Molecular Formula | C19H16N6O3S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]benzamide |
| SMILES | Cc1nnnn1-c1cccc(NC(=O)c2cccc(CN3C(=O)CSC3=O)c2)c1 |
| InChI | InChI=1S/C19H16N6O3S/c1-12-21-22-23-25(12)16-7-3-6-15(9-16)20-18(27)14-5-2-4-13(8-14)10-24-17(26)11-29-19(24)28/h2-9H,10-11H2,1H3,(H,20,27) |
| InChIKey | AZUHVPPZCKNTQW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|