C22H22N4O5S2 — CID 55768690
3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide (PubChem CID 55768690) has the molecular formula C22H22N4O5S2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide.
| Compound Name | 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 55768690 |
| Molecular Formula | C22H22N4O5S2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 3-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide |
| SMILES | CN1CCC/C1=N\S(=O)(=O)c1cccc(NC(=O)c2cccc(CN3C(=O)CSC3=O)c2)c1 |
| InChI | InChI=1S/C22H22N4O5S2/c1-25-10-4-9-19(25)24-33(30,31)18-8-3-7-17(12-18)23-21(28)16-6-2-5-15(11-16)13-26-20(27)14-32-22(26)29/h2-3,5-8,11-12H,4,9-10,13-14H2,1H3,(H,23,28)/b24-19+ |
| InChIKey | MHQFAEJDLPOGFL-LYBHJNIJSA-N |
| XLogP | 2.95 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|