C16H18N4O3S2 — CID 60530494
4-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1,3-thiazole-5-carboxamide (PubChem CID 60530494) has the molecular formula C16H18N4O3S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 4-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 60530494 |
| Molecular Formula | C16H18N4O3S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)Nc1cccc(S(=O)(=O)/N=C2\CCCN2C)c1 |
| InChI | InChI=1S/C16H18N4O3S2/c1-11-15(24-10-17-11)16(21)18-12-5-3-6-13(9-12)25(22,23)19-14-7-4-8-20(14)2/h3,5-6,9-10H,4,7-8H2,1-2H3,(H,18,21)/b19-14+ |
| InChIKey | XVZXTOZJBLZAHR-XMHGGMMESA-N |
| XLogP | 2.52 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|