C18H23N5O3S — CID 60530681
2-(3,5-dimethylpyrazol-1-yl)-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]acetamide (PubChem CID 60530681) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]acetamide.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 60530681 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]acetamide |
| SMILES | Cc1cc(C)n(CC(=O)Nc2cccc(S(=O)(=O)/N=C3\CCCN3C)c2)n1 |
| InChI | InChI=1S/C18H23N5O3S/c1-13-10-14(2)23(20-13)12-18(24)19-15-6-4-7-16(11-15)27(25,26)21-17-8-5-9-22(17)3/h4,6-7,10-11H,5,8-9,12H2,1-3H3,(H,19,24)/b21-17+ |
| InChIKey | ZTWMALHGNBKHAT-HEHNFIMWSA-N |
| XLogP | 1.95 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|