C22H31N5O3S — CID 60549512
N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide (PubChem CID 60549512) has the molecular formula C22H31N5O3S and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide.
| Compound Name | N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 60549512 |
| Molecular Formula | C22H31N5O3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-(1,3,5-trimethylpyrazol-4-yl)propanamide |
| SMILES | Cc1nn(C)c(C)c1CCC(=O)Nc1cccc(S(=O)(=O)/N=C2\CCCCCN2C)c1 |
| InChI | InChI=1S/C22H31N5O3S/c1-16-20(17(2)27(4)24-16)12-13-22(28)23-18-9-8-10-19(15-18)31(29,30)25-21-11-6-5-7-14-26(21)3/h8-10,15H,5-7,11-14H2,1-4H3,(H,23,28)/b25-21+ |
| InChIKey | YJACMSQNRGWOMW-NJNXFGOHSA-N |
| XLogP | 3.20 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|