C20H24ClN3O3S2 — CID 76867393
3-(5-chlorothiophen-2-yl)-N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]propanamide (PubChem CID 76867393) has the molecular formula C20H24ClN3O3S2 and a molecular weight of 454.02 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)-N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]propanamide.
| Compound Name | 3-(5-chlorothiophen-2-yl)-N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]propanamide |
|---|---|
| PubChem CID | 76867393 |
| Molecular Formula | C20H24ClN3O3S2 |
| Molecular Weight | 454.02 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)-N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]propanamide |
| SMILES | CN1CCCCCC1=NS(=O)(=O)c1cccc(NC(=O)CCc2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C20H24ClN3O3S2/c1-24-13-4-2-3-8-19(24)23-29(26,27)17-7-5-6-15(14-17)22-20(25)12-10-16-9-11-18(21)28-16/h5-7,9,11,14H,2-4,8,10,12-13H2,1H3,(H,22,25) |
| InChIKey | RQWJVXXDEUKXNY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.02 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|