C20H23N3O3S2 — CID 75895039
N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 75895039) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 75895039 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CN1CCCCCC1=NS(=O)(=O)c1cccc(NC(=O)C=Cc2cccs2)c1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-23-13-4-2-3-10-19(23)22-28(25,26)18-9-5-7-16(15-18)21-20(24)12-11-17-8-6-14-27-17/h5-9,11-12,14-15H,2-4,10,13H2,1H3,(H,21,24) |
| InChIKey | VFPGWECYLUYYIR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|