C22H28N4O3S — CID 60549464
3-(dimethylamino)-N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]benzamide (PubChem CID 60549464) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 60549464 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 3-(dimethylamino)-N-[3-[(Z)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]benzamide |
| SMILES | CN1CCCCC/C1=N/S(=O)(=O)c1cccc(NC(=O)c2cccc(N(C)C)c2)c1 |
| InChI | InChI=1S/C22H28N4O3S/c1-25(2)19-11-7-9-17(15-19)22(27)23-18-10-8-12-20(16-18)30(28,29)24-21-13-5-4-6-14-26(21)3/h7-12,15-16H,4-6,13-14H2,1-3H3,(H,23,27)/b24-21- |
| InChIKey | IIQZUQVICZJRKL-FLFQWRMESA-N |
| XLogP | 3.60 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|