C19H21ClN4O3S — CID 55810712
4-chloro-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]pyridine-2-carboxamide (PubChem CID 55810712) has the molecular formula C19H21ClN4O3S and a molecular weight of 420.92 g/mol. Its IUPAC name is 4-chloro-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 55810712 |
| Molecular Formula | C19H21ClN4O3S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 4-chloro-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]pyridine-2-carboxamide |
| SMILES | CN1CCCCC/C1=N\S(=O)(=O)c1cccc(NC(=O)c2cc(Cl)ccn2)c1 |
| InChI | InChI=1S/C19H21ClN4O3S/c1-24-11-4-2-3-8-18(24)23-28(26,27)16-7-5-6-15(13-16)22-19(25)17-12-14(20)9-10-21-17/h5-7,9-10,12-13H,2-4,8,11H2,1H3,(H,22,25)/b23-18+ |
| InChIKey | GRLKRCZMNIGIIQ-PTGBLXJZSA-N |
| XLogP | 3.58 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|