C25H29N5O3S — CID 55992188
2,5-dimethyl-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-1-pyridin-3-ylpyrrole-3-carboxamide (PubChem CID 55992188) has the molecular formula C25H29N5O3S and a molecular weight of 479.61 g/mol. Its IUPAC name is 2,5-dimethyl-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-1-pyridin-3-ylpyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-1-pyridin-3-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55992188 |
| Molecular Formula | C25H29N5O3S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2,5-dimethyl-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-1-pyridin-3-ylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(S(=O)(=O)/N=C3\CCCCCN3C)c2)c(C)n1-c1cccnc1 |
| InChI | InChI=1S/C25H29N5O3S/c1-18-15-23(19(2)30(18)21-10-8-13-26-17-21)25(31)27-20-9-7-11-22(16-20)34(32,33)28-24-12-5-4-6-14-29(24)3/h7-11,13,15-17H,4-6,12,14H2,1-3H3,(H,27,31)/b28-24+ |
| InChIKey | FGOXAYMNWYQUNP-ZZIIXHQDSA-N |
| XLogP | 4.33 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|