C16H19N5O3S2 — CID 55920328
N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]thiadiazole-5-carboxamide (PubChem CID 55920328) has the molecular formula C16H19N5O3S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]thiadiazole-5-carboxamide.
| Compound Name | N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 55920328 |
| Molecular Formula | C16H19N5O3S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]thiadiazole-5-carboxamide |
| SMILES | CN1CCCCC/C1=N\S(=O)(=O)c1cccc(NC(=O)c2cnns2)c1 |
| InChI | InChI=1S/C16H19N5O3S2/c1-21-9-4-2-3-8-15(21)19-26(23,24)13-7-5-6-12(10-13)18-16(22)14-11-17-20-25-14/h5-7,10-11H,2-4,8-9H2,1H3,(H,18,22)/b19-15+ |
| InChIKey | KVOIYYCFQSEKDZ-XDJHFCHBSA-N |
| XLogP | 2.38 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|