C19H21N3O5S2 — CID 51957722
N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-4-methylsulfonylbenzamide (PubChem CID 51957722) has the molecular formula C19H21N3O5S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 51957722 |
| Molecular Formula | C19H21N3O5S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-4-methylsulfonylbenzamide |
| SMILES | CN1CCCC1=NS(=O)(=O)c1cccc(NC(=O)c2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C19H21N3O5S2/c1-22-12-4-7-18(22)21-29(26,27)17-6-3-5-15(13-17)20-19(23)14-8-10-16(11-9-14)28(2,24)25/h3,5-6,8-11,13H,4,7,12H2,1-2H3,(H,20,23) |
| InChIKey | DNOWCBKZXYGVQD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|