C21H22N4O3S — CID 60557496
2-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1H-indole-3-carboxamide (PubChem CID 60557496) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1H-indole-3-carboxamide.
| Compound Name | 2-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 60557496 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2-methyl-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)Nc1cccc(S(=O)(=O)/N=C2\CCCN2C)c1 |
| InChI | InChI=1S/C21H22N4O3S/c1-14-20(17-9-3-4-10-18(17)22-14)21(26)23-15-7-5-8-16(13-15)29(27,28)24-19-11-6-12-25(19)2/h3-5,7-10,13,22H,6,11-12H2,1-2H3,(H,23,26)/b24-19+ |
| InChIKey | HXGUNKPVJHJUCJ-LYBHJNIJSA-N |
| XLogP | 3.54 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|