C22H23FN4O3S — CID 76868188
5-fluoro-N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-1H-indole-2-carboxamide (PubChem CID 76868188) has the molecular formula C22H23FN4O3S and a molecular weight of 442.52 g/mol. Its IUPAC name is 5-fluoro-N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-1H-indole-2-carboxamide.
| Compound Name | 5-fluoro-N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 76868188 |
| Molecular Formula | C22H23FN4O3S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 5-fluoro-N-[3-[(1-methylazepan-2-ylidene)amino]sulfonylphenyl]-1H-indole-2-carboxamide |
| SMILES | CN1CCCCCC1=NS(=O)(=O)c1cccc(NC(=O)c2cc3cc(F)ccc3[nH]2)c1 |
| InChI | InChI=1S/C22H23FN4O3S/c1-27-11-4-2-3-8-21(27)26-31(29,30)18-7-5-6-17(14-18)24-22(28)20-13-15-12-16(23)9-10-19(15)25-20/h5-7,9-10,12-14,25H,2-4,8,11H2,1H3,(H,24,28) |
| InChIKey | OSXNKNIRRUDEJT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|