C24H28N4O4S — CID 55813443
N-methyl-4-[3-[3-[(1-methylazepan-2-ylidene)amino]sulfonylanilino]-3-oxoprop-1-enyl]benzamide (PubChem CID 55813443) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is N-methyl-4-[3-[3-[(1-methylazepan-2-ylidene)amino]sulfonylanilino]-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-methyl-4-[3-[3-[(1-methylazepan-2-ylidene)amino]sulfonylanilino]-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 55813443 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N-methyl-4-[3-[3-[(1-methylazepan-2-ylidene)amino]sulfonylanilino]-3-oxoprop-1-enyl]benzamide |
| SMILES | CNC(=O)c1ccc(C=CC(=O)Nc2cccc(S(=O)(=O)N=C3CCCCCN3C)c2)cc1 |
| InChI | InChI=1S/C24H28N4O4S/c1-25-24(30)19-13-10-18(11-14-19)12-15-23(29)26-20-7-6-8-21(17-20)33(31,32)27-22-9-4-3-5-16-28(22)2/h6-8,10-15,17H,3-5,9,16H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | JBQAWWWLPDITQB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|