C18H18BrN3O3S2 — CID 76866032
3-(5-bromothiophen-2-yl)-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide (PubChem CID 76866032) has the molecular formula C18H18BrN3O3S2 and a molecular weight of 468.40 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide.
| Compound Name | 3-(5-bromothiophen-2-yl)-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76866032 |
| Molecular Formula | C18H18BrN3O3S2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide |
| SMILES | CN1CCCC1=NS(=O)(=O)c1cccc(NC(=O)C=Cc2ccc(Br)s2)c1 |
| InChI | InChI=1S/C18H18BrN3O3S2/c1-22-11-3-6-17(22)21-27(24,25)15-5-2-4-13(12-15)20-18(23)10-8-14-7-9-16(19)26-14/h2,4-5,7-10,12H,3,6,11H2,1H3,(H,20,23) |
| InChIKey | HVAYRDGFXNKZRT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|