C23H22N4O3S — CID 60530655
(E)-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-3-quinolin-8-ylprop-2-enamide (PubChem CID 60530655) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is (E)-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-3-quinolin-8-ylprop-2-enamide.
| Compound Name | (E)-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-3-quinolin-8-ylprop-2-enamide |
|---|---|
| PubChem CID | 60530655 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (E)-N-[3-[(E)-(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-3-quinolin-8-ylprop-2-enamide |
| SMILES | CN1CCC/C1=N\S(=O)(=O)c1cccc(NC(=O)/C=C/c2cccc3cccnc23)c1 |
| InChI | InChI=1S/C23H22N4O3S/c1-27-15-5-11-21(27)26-31(29,30)20-10-3-9-19(16-20)25-22(28)13-12-18-7-2-6-17-8-4-14-24-23(17)18/h2-4,6-10,12-14,16H,5,11,15H2,1H3,(H,25,28)/b13-12+,26-21+ |
| InChIKey | AKFZDGLPCHZIBE-WJZSJVRASA-N |
| XLogP | 3.70 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|