C20H19F2N3O3S — CID 76884474
3-(2,6-difluorophenyl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide (PubChem CID 76884474) has the molecular formula C20H19F2N3O3S and a molecular weight of 419.45 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide.
| Compound Name | 3-(2,6-difluorophenyl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 76884474 |
| Molecular Formula | C20H19F2N3O3S |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 3-(2,6-difluorophenyl)-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]prop-2-enamide |
| SMILES | CN1CCCC1=NS(=O)(=O)c1ccc(NC(=O)C=Cc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C20H19F2N3O3S/c1-25-13-3-6-19(25)24-29(27,28)15-9-7-14(8-10-15)23-20(26)12-11-16-17(21)4-2-5-18(16)22/h2,4-5,7-12H,3,6,13H2,1H3,(H,23,26) |
| InChIKey | HYALRIJPUOUMQE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|