C18H16ClF2N3O3S — CID 51956833
2-chloro-4,5-difluoro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide (PubChem CID 51956833) has the molecular formula C18H16ClF2N3O3S and a molecular weight of 427.86 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 51956833 |
| Molecular Formula | C18H16ClF2N3O3S |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]benzamide |
| SMILES | CN1CCCC1=NS(=O)(=O)c1ccc(NC(=O)c2cc(F)c(F)cc2Cl)cc1 |
| InChI | InChI=1S/C18H16ClF2N3O3S/c1-24-8-2-3-17(24)23-28(26,27)12-6-4-11(5-7-12)22-18(25)13-9-15(20)16(21)10-14(13)19/h4-7,9-10H,2-3,8H2,1H3,(H,22,25) |
| InChIKey | ZFNNSKNYJBXDKI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|