C22H22FN5O3S — CID 51966474
7-fluoro-2,3-dimethyl-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]quinoxaline-5-carboxamide (PubChem CID 51966474) has the molecular formula C22H22FN5O3S and a molecular weight of 455.52 g/mol. Its IUPAC name is 7-fluoro-2,3-dimethyl-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]quinoxaline-5-carboxamide.
| Compound Name | 7-fluoro-2,3-dimethyl-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 51966474 |
| Molecular Formula | C22H22FN5O3S |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 7-fluoro-2,3-dimethyl-N-[4-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]quinoxaline-5-carboxamide |
| SMILES | Cc1nc2cc(F)cc(C(=O)Nc3ccc(S(=O)(=O)N=C4CCCN4C)cc3)c2nc1C |
| InChI | InChI=1S/C22H22FN5O3S/c1-13-14(2)25-21-18(11-15(23)12-19(21)24-13)22(29)26-16-6-8-17(9-7-16)32(30,31)27-20-5-4-10-28(20)3/h6-9,11-12H,4-5,10H2,1-3H3,(H,26,29) |
| InChIKey | SMQLLWDFQQHQFJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|