C22H22N4O3S — CID 55882150
2-methyl-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]quinoline-4-carboxamide (PubChem CID 55882150) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 2-methyl-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]quinoline-4-carboxamide.
| Compound Name | 2-methyl-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 55882150 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-methyl-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(S(=O)(=O)N=C3CCCN3C)c2)c2ccccc2n1 |
| InChI | InChI=1S/C22H22N4O3S/c1-15-13-19(18-9-3-4-10-20(18)23-15)22(27)24-16-7-5-8-17(14-16)30(28,29)25-21-11-6-12-26(21)2/h3-5,7-10,13-14H,6,11-12H2,1-2H3,(H,24,27) |
| InChIKey | HGAZIHOGGWBLQV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|