C21H25FN4O5S2 — CID 55880493
2-fluoro-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-(propan-2-ylsulfamoyl)benzamide (PubChem CID 55880493) has the molecular formula C21H25FN4O5S2 and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-fluoro-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | 2-fluoro-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55880493 |
| Molecular Formula | C21H25FN4O5S2 |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 2-fluoro-N-[3-[(1-methylpyrrolidin-2-ylidene)amino]sulfonylphenyl]-5-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(F)c(C(=O)Nc2cccc(S(=O)(=O)N=C3CCCN3C)c2)c1 |
| InChI | InChI=1S/C21H25FN4O5S2/c1-14(2)24-32(28,29)17-9-10-19(22)18(13-17)21(27)23-15-6-4-7-16(12-15)33(30,31)25-20-8-5-11-26(20)3/h4,6-7,9-10,12-14,24H,5,8,11H2,1-3H3,(H,23,27) |
| InChIKey | SZDJIGJDSPXHDN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|