C20H22F2N4O3S2 — CID 55992434
2-(difluoromethylsulfanyl)-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]pyridine-3-carboxamide (PubChem CID 55992434) has the molecular formula C20H22F2N4O3S2 and a molecular weight of 468.55 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]pyridine-3-carboxamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55992434 |
| Molecular Formula | C20H22F2N4O3S2 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-[3-[(E)-(1-methylazepan-2-ylidene)amino]sulfonylphenyl]pyridine-3-carboxamide |
| SMILES | CN1CCCCC/C1=N\S(=O)(=O)c1cccc(NC(=O)c2cccnc2SC(F)F)c1 |
| InChI | InChI=1S/C20H22F2N4O3S2/c1-26-12-4-2-3-10-17(26)25-31(28,29)15-8-5-7-14(13-15)24-18(27)16-9-6-11-23-19(16)30-20(21)22/h5-9,11,13,20H,2-4,10,12H2,1H3,(H,24,27)/b25-17+ |
| InChIKey | FQRRSMJDWYROOP-KOEQRZSOSA-N |
| XLogP | 4.24 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|