C14H12F2N2O3S2 — CID 134013198
2-(difluoromethylsulfanyl)-N-(3-methylsulfonylphenyl)pyridine-3-carboxamide (PubChem CID 134013198) has the molecular formula C14H12F2N2O3S2 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-(3-methylsulfonylphenyl)pyridine-3-carboxamide.
| Compound Name | 2-(difluoromethylsulfanyl)-N-(3-methylsulfonylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 134013198 |
| Molecular Formula | C14H12F2N2O3S2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-(3-methylsulfonylphenyl)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)c2cccnc2SC(F)F)c1 |
| InChI | InChI=1S/C14H12F2N2O3S2/c1-23(20,21)10-5-2-4-9(8-10)18-12(19)11-6-3-7-17-13(11)22-14(15)16/h2-8,14H,1H3,(H,18,19) |
| InChIKey | AIWHJQWSDKSGED-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |