C20H19N3O3S2 — CID 4290143
N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-methylsulfanylpyridine-3-carboxamide (PubChem CID 4290143) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-methylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-methylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 4290143 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-methylsulfanylpyridine-3-carboxamide |
| SMILES | CSc1ncccc1C(=O)Nc1cccc(S(=O)(=O)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C20H19N3O3S2/c1-23(16-9-4-3-5-10-16)28(25,26)17-11-6-8-15(14-17)22-19(24)18-12-7-13-21-20(18)27-2/h3-14H,1-2H3,(H,22,24) |
| InChIKey | XRUOJYBHGYBFHO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |