C17H21N3O3S2 — CID 4043210
N-[3-(diethylsulfamoyl)phenyl]-2-methylsulfanylpyridine-3-carboxamide (PubChem CID 4043210) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)phenyl]-2-methylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[3-(diethylsulfamoyl)phenyl]-2-methylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 4043210 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[3-(diethylsulfamoyl)phenyl]-2-methylsulfanylpyridine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)c2cccnc2SC)c1 |
| InChI | InChI=1S/C17H21N3O3S2/c1-4-20(5-2)25(22,23)14-9-6-8-13(12-14)19-16(21)15-10-7-11-18-17(15)24-3/h6-12H,4-5H2,1-3H3,(H,19,21) |
| InChIKey | KKANKBDZTZRXMN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |