C23H18N2O5S — CID 3988955
N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-oxochromene-3-carboxamide (PubChem CID 3988955) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 3988955 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-[3-[methyl(phenyl)sulfamoyl]phenyl]-2-oxochromene-3-carboxamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(NC(=O)c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C23H18N2O5S/c1-25(18-10-3-2-4-11-18)31(28,29)19-12-7-9-17(15-19)24-22(26)20-14-16-8-5-6-13-21(16)30-23(20)27/h2-15H,1H3,(H,24,26) |
| InChIKey | GYQBKAVCZFZJIS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|