C22H22N2O5S — CID 3566147
N-[3-(azepan-1-ylsulfonyl)phenyl]-2-oxochromene-3-carboxamide (PubChem CID 3566147) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 3566147 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCCCC2)c1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C22H22N2O5S/c25-21(19-14-16-8-3-4-11-20(16)29-22(19)26)23-17-9-7-10-18(15-17)30(27,28)24-12-5-1-2-6-13-24/h3-4,7-11,14-15H,1-2,5-6,12-13H2,(H,23,25) |
| InChIKey | HMPVOLSKKRMYCT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|