C20H17BrN2O5S — CID 16645643
6-bromo-2-oxo-N-(4-pyrrolidin-1-ylsulfonylphenyl)chromene-3-carboxamide (PubChem CID 16645643) has the molecular formula C20H17BrN2O5S and a molecular weight of 477.34 g/mol. Its IUPAC name is 6-bromo-2-oxo-N-(4-pyrrolidin-1-ylsulfonylphenyl)chromene-3-carboxamide.
| Compound Name | 6-bromo-2-oxo-N-(4-pyrrolidin-1-ylsulfonylphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 16645643 |
| Molecular Formula | C20H17BrN2O5S |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | 6-bromo-2-oxo-N-(4-pyrrolidin-1-ylsulfonylphenyl)chromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCC2)cc1)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C20H17BrN2O5S/c21-14-3-8-18-13(11-14)12-17(20(25)28-18)19(24)22-15-4-6-16(7-5-15)29(26,27)23-9-1-2-10-23/h3-8,11-12H,1-2,9-10H2,(H,22,24) |
| InChIKey | IZNGTWFPJSPZSW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|