C23H21BrN2O3S — CID 46385831
N-(4-bromophenyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 46385831) has the molecular formula C23H21BrN2O3S and a molecular weight of 485.40 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | N-(4-bromophenyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 46385831 |
| Molecular Formula | C23H21BrN2O3S |
| Molecular Weight | 485.40 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | N-(4-bromophenyl)-4-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1)c1ccc(-c2ccc(S(=O)(=O)N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H21BrN2O3S/c24-20-9-11-21(12-10-20)25-23(27)19-5-3-17(4-6-19)18-7-13-22(14-8-18)30(28,29)26-15-1-2-16-26/h3-14H,1-2,15-16H2,(H,25,27) |
| InChIKey | BTJQTSIHTGAJBR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |