C18H16N2O3S2 — CID 17396939
N-[3-[methyl(phenyl)sulfamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 17396939) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[3-[methyl(phenyl)sulfamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[methyl(phenyl)sulfamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17396939 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-[3-[methyl(phenyl)sulfamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C18H16N2O3S2/c1-20(15-8-3-2-4-9-15)25(22,23)16-10-5-7-14(13-16)19-18(21)17-11-6-12-24-17/h2-13H,1H3,(H,19,21) |
| InChIKey | PXKIUXHPASGFNT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |