C19H14ClF2N3O4S2 — CID 24673103
N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide (PubChem CID 24673103) has the molecular formula C19H14ClF2N3O4S2 and a molecular weight of 485.92 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide.
| Compound Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24673103 |
| Molecular Formula | C19H14ClF2N3O4S2 |
| Molecular Weight | 485.92 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(difluoromethylsulfanyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)Nc2cccc(Cl)c2)ccc1O)c1cccnc1SC(F)F |
| InChI | InChI=1S/C19H14ClF2N3O4S2/c20-11-3-1-4-12(9-11)25-31(28,29)13-6-7-16(26)15(10-13)24-17(27)14-5-2-8-23-18(14)30-19(21)22/h1-10,19,25-26H,(H,24,27) |
| InChIKey | XCBMTNZJAUTJJM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|