C18H13ClF2N2O5S2 — CID 26970738
N-(3-chlorophenyl)-3-[(3,4-difluorophenyl)sulfonylamino]-4-hydroxybenzenesulfonamide (PubChem CID 26970738) has the molecular formula C18H13ClF2N2O5S2 and a molecular weight of 474.89 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-[(3,4-difluorophenyl)sulfonylamino]-4-hydroxybenzenesulfonamide.
| Compound Name | N-(3-chlorophenyl)-3-[(3,4-difluorophenyl)sulfonylamino]-4-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 26970738 |
| Molecular Formula | C18H13ClF2N2O5S2 |
| Molecular Weight | 474.89 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | N-(3-chlorophenyl)-3-[(3,4-difluorophenyl)sulfonylamino]-4-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Cl)c1)c1ccc(O)c(NS(=O)(=O)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C18H13ClF2N2O5S2/c19-11-2-1-3-12(8-11)22-29(25,26)14-5-7-18(24)17(10-14)23-30(27,28)13-4-6-15(20)16(21)9-13/h1-10,22-24H |
| InChIKey | UKALXZCVVNJVCC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.89 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|