C20H19ClN2O5S2 — CID 25391427
N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2,4-dimethylbenzenesulfonamide (PubChem CID 25391427) has the molecular formula C20H19ClN2O5S2 and a molecular weight of 466.97 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2,4-dimethylbenzenesulfonamide.
| Compound Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 25391427 |
| Molecular Formula | C20H19ClN2O5S2 |
| Molecular Weight | 466.97 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(S(=O)(=O)Nc3cccc(Cl)c3)ccc2O)c(C)c1 |
| InChI | InChI=1S/C20H19ClN2O5S2/c1-13-6-9-20(14(2)10-13)30(27,28)23-18-12-17(7-8-19(18)24)29(25,26)22-16-5-3-4-15(21)11-16/h3-12,22-24H,1-2H3 |
| InChIKey | YUURASIOJVMXRG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.97 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|