C19H13ClF2N2O4S — CID 36924914
N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-3,5-difluorobenzamide (PubChem CID 36924914) has the molecular formula C19H13ClF2N2O4S and a molecular weight of 438.84 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-3,5-difluorobenzamide.
| Compound Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 36924914 |
| Molecular Formula | C19H13ClF2N2O4S |
| Molecular Weight | 438.84 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-3,5-difluorobenzamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)Nc2cccc(Cl)c2)ccc1O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C19H13ClF2N2O4S/c20-12-2-1-3-15(8-12)24-29(27,28)16-4-5-18(25)17(10-16)23-19(26)11-6-13(21)9-14(22)7-11/h1-10,24-25H,(H,23,26) |
| InChIKey | QDOIVKIYVWMRER-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.84 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|