C20H16ClN3O7S — CID 24673057
N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-4-methoxy-3-nitrobenzamide (PubChem CID 24673057) has the molecular formula C20H16ClN3O7S and a molecular weight of 477.88 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 24673057 |
| Molecular Formula | C20H16ClN3O7S |
| Molecular Weight | 477.88 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(S(=O)(=O)Nc3cccc(Cl)c3)ccc2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16ClN3O7S/c1-31-19-8-5-12(9-17(19)24(27)28)20(26)22-16-11-15(6-7-18(16)25)32(29,30)23-14-4-2-3-13(21)10-14/h2-11,23,25H,1H3,(H,22,26) |
| InChIKey | PEMSLQAWYWFROE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.88 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|